| Cas No.: | 28395-03-1 |
| Chemical Name: | Bumetanide |
| Synonyms: | 3-(Butylamino)-4-phenoxy-5-sulfamoylbenzoic acid;Bumetanide (FDA);Bumetanide;2-phenoxy-3-butylamino-5-carboxybenzenesulfonamide;[3H]-Bumetanide;3-(Aminosulfonyl)-5-(butylamino)-4-phenoxybenzoic acid;3-(butylamino-)-4-phenoxy-5-sulfamoylbenzoic acid;Bumetanida;Bumetanidum;Bumex;Burinex;Fontego;Fordiuran;Lunetoron;PF 1593;Ro 10-6338;Segurex;Aquazone;Diurama;Butinat;Yurinex;Cambiex;Bumetanidum [INN-Latin];Bumetanida [INN-Spanish];Lixil-Leo;Benzoic acid, 3-(aminosulfonyl)-5-(butylamino)-4-phenoxy-;0Y2S3XUQ5H;MLS000028457;Bumethanide;C17H20N2O5S;BENZOIC ACID, 3-(BUT |
| SMILES: | S(C1=C([H])C(C(=O)O[H])=C([H])C(=C1OC1C([H])=C([H])C([H])=C([H])C=1[H])N([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H])(N([H])[H])(=O)=O |
| Formula: | C17H20N2O5S |
| M.Wt: | 364.4161 |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | Bumetanide(Ro 10-6338; PF 1593) is an inhibitor of Na(+)-K(+)-2Cl(-) co-transporter (NKCC) with an IC50 of 0.6 uM. |
| In Vivo: | ntraperitoneal injection of 50 or 100 mg bumetanide/kg body weight resulted in an acute and transient hyperglycaemia. Pretreatment with 240 mg probenecid/kg body weight reduced the diuretic effect but potentiated the hyperglycaemic effect of bumetanide (50 mg/kg body weight). The glucose tolerance was impaired, and there was an elevated serum glucose and glucose/insulin ratio 2 h after a single injection of bumetanide (100 mg/kg body weight) [3]. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
