| Cas No.: | 1627126-59-3 |
| Chemical Name: | 3-((5-bromothiophen-2-yl)methyl)-2-((Z)-((E)-5-(6-chloro-3-methylbenzo[d]thiazol-2(3H)-ylidene)-3-ethyl-4-oxothiazolidin-2-ylidene)methyl)thiazol-3-ium chloride |
| Synonyms: | JG231 |
| SMILES: | S1C=C[N+](CC2SC(Br)=CC=2)=C1/C=C1/N(CC)C(=O)/C(=C2/N(C)C3=CC=C(Cl)C=C3S/2)/S/1.[Cl-] |
| Formula: | C22H18BrCl2N3Os4 |
| M.Wt: | 619.45 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | JG-231 is an allosteric inhibitor that disrupts the Hsp70-BAG3 interaction (Ki=0.11 uM), inhibits breast cancer cells MCF-7 and MDA-MB-231 with IC50 of 0.12 and 0.25 uM, respectively; reduces tumor burden in an MDA-MB-231 xenograft model (4 mg/kg, ip). |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
