| Cas No.: | 1006388-38-0 |
| Chemical Name: | N2-acetyl-L-arginyl-2-methylalanyl-L-arginyl-α-methylL-phenylalaninamide |
| Synonyms: | Ac-Arg-Aib-Arg-α(Me)Phe-NH2 |
| SMILES: | CC(=O)N[C@@H](CCCN=C(N)N)C(=O)NC(C)(C)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@](C)(CC1=CC=CC=C1)C(=O)N |
| Formula: | C28H47N11O5 |
| M.Wt: | 617.756 |
| Sotrage: | 2 years -20°C Powder, 2 weeks4°C in DMSO,6 months-80°C in DMSO |
| Publication: | Plasminogen Activator Inhibitor-1 (PAI-1) |
| Description: | Cenupatide is an urokinase plasminogen activator receptor (uPAR) inhibitor for treating disorders associated altered cell migration, such as cancer. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
