To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
| Cas No.: | 509092-16-4 |
| Chemical Name: | 2-Amino-2-(2-(2-chloro-4-(3-benzyloxyphenylthio)phenyl)ethyl)-1,3-propanediol |
| Synonyms: | KRP-203;KRP203 |
| SMILES: | C(O)C(N)(CCC1=CC=C(SC2=CC=CC(OCC3=CC=CC=C3)=C2)C=C1Cl)CO |
| Formula: | C24H26ClNO3S |
| M.Wt: | 443.986 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | A synthetic immunosuppressant that functions as a S1P1 receptor agonist; significantly inhibits infiltration of inflammatory cells, expression of endothelin-1 and TGF-beta1, and IgG deposition and eventually attenuates neointimal formation and myocardial fibrosis; prolongs graft survival and attenuates chronic rejection in rat skin and heart allografts. |