| Cas No.: | 749263-43-2 |
| Chemical Name: | 2-amino-4-(2-chloro-4-((3-hydroxyphenyl)thio)phenyl)-2-(hydroxymethyl)butyl dihydrogen phosphate |
| Synonyms: | SPM242 racemate |
| SMILES: | P(OCC(N)(CO)CCC1=CC=C(SC2=CC=CC(O)=C2)C=C1Cl)(O)(O)=O |
| Formula: | C17H21ClNO6PS |
| M.Wt: | 433.84 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | A potent, selective S1P3 antagonist with Ki of 0.25 nM; displays selectivity over other S1P receptors. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
