| Cas No.: | 2244904-70-7 |
| Chemical Name: | (R)-6,7-dimethoxy-2-methyl-N-(1-(4-(2-((methylamino)methyl)phenyl)thiophen-2-yl)ethyl)quinazolin-4-amine |
| Synonyms: | BAY-293,BAY 293,BAY293 |
| SMILES: | CC1=NC2=CC(=C(C=C2C(=N1)N[C@H](C)C3=CC(=CS3)C4=CC=CC=C4CNC)OC)OC |
| Formula: | C25H28N4O2S |
| M.Wt: | 448.585 |
| Sotrage: | 2 years -20°C Powder, 2 weeks4°C in DMSO,6 months-80°C in DMSO |
| Description: | BAY-293 is a potent SOS1 inhibitors that block RAS activation via disruption of the RAS-SOS1 interaction with an IC50 of 21 nM[1]. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
