| Cas No.: | 1622849-43-7 |
| Chemical Name: | (S)-5-benzyl-N-(7,9-difluoro-2-oxo-2,3,4,5-tetrahydro-1H-benzo[b]azepin-3-yl)-4H-1,2,4-triazole-3-carboxamide |
| Synonyms: | GSK3145095,GSK-3145095,GSK 3145095 |
| SMILES: | FC1=CC(F)=CC2=C1NC([C@@H](NC(C3=NNC(CC4=CC=CC=C4)=N3)=O)CC2)=O |
| Formula: | C20H17F2N5O2 |
| M.Wt: | 397.38 |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | GSK3145095 is a RIP1 kinase inhibitor with an IC50 of 6.3 nM [1]. |
| In Vitro: | GSK3145095 potently blocks the TNF response as shown by determination of overall cell viability as measured by cellular ATP levels (IC50 = 1.6 nM), cell death as measured by LDH release (IC50 = 0.5 nM) and RIP1-dependent inflammatory cytokine MIP-1β production, either as absolute levels for protein, or fold changes in mRNA expression (IC50 = 0.4 nM) [1]. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
