| Cas No.: | 496775-61-2 |
| Chemical Name: | Eltrombopag free base |
| Synonyms: | SB497115; SB-497115; SB 497115; SB497115GR; Eltrombopag; Brand name: PROMACTA |
| SMILES: | O=C(C1=CC(C2=CC=CC(N/N=C3C(C)=NN(C4=CC=C(C)C(C)=C4)C/3=O)=C2O)=CC=C1)O |
| Formula: | C25H22N4O4 |
| M.Wt: | 442.47 |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | Eltrombopag is a thrombopoietin (TPO) receptor agonist developed for certain conditions that lead to thrombocytopenia. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
