| Cas No.: | 153439-40-8 |
| Chemical Name: | 2-(4-(1-hydroxy-4-(4-(hydroxydiphenylmethyl)piperidin-1-yl)butyl)phenyl)-2-methylpropanoic acid hydrochloride |
| Synonyms: | Allegra; Fexofenadine HCl; MDL-16-455A; MDL16455A; MDL 16 455A; Telfast |
| SMILES: | Cl.OC(C1C=CC(C(C(=O)O)(C)C)=CC=1)CCCN1CCC(C(C2C=CC=CC=2)(O)C2C=CC=CC=2)CC1 |
| Formula: | C32H40ClNO4 |
| M.Wt: | 538.12 |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | Fexofenadine is a third-generation antihistamine pharmaceutical drug used in the treatment of allergy symptoms, such as hay fever, nasal congestion, and urticaria. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
