| Cas No.: | 321695-57-2 |
| Chemical Name: | L002 |
| Synonyms: | L002;4-[O-[(4-Methoxyphenyl)sulfonyl]oxime]-2,6-dimethyl-2,5-cyclohexadiene-1,4-dione;NSC764414 |
| SMILES: | COC1=CC=C(S(O/N=C2\C=C(C)C(=O)C(C)=C\2)(=O)=O)C=C1 |
| Formula: | C15H15NO5S |
| M.Wt: | 321.348303079605 |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | L002 is a novel potent, specific acetyltransferase p300 (KAT3B) inhibitor with an IC50 of 1.98 uM. L002 has weak inhibitory effects against PCAF and GCN5 (IC50s =35 and 34 µM, respectively) and is specific for p300 over a panel of additional acetyltransferases, deacetylases, and methyltransferases[1]. L002 blocks histone acetylation and p53 acetylation, and inhibits STAT3 activation[2]. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
