| Cas No.: | 85700-55-6 |
| SMILES: | O[C@H]1C[C@H](N2C)[C@@H]3O[C@@H]3[C@H]2C1.Cl |
| Formula: | C8H13NO2.HCl |
| M.Wt: | 191.66 |
| Purity: | >99% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | Scopine Hcl salt is the metabolite of anisodine, which is a α1-adrenergic receptor agonist and used in the treatment of acute circulatory shock. |
| References: | [1]. http://en.wikipedia.org/wiki/Scopine |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
.png)