| Cas No.: | 84-82-2 |
| Chemical Name: | Toxoflavin |
| Synonyms: | Pyrimido[5,4-e]-1,2,4-triazine-5,7(1H,6H)-dione,1,6-dimethyl-;1,6-dimethylpyrimido[5,4-e][1,2,4]triazine-5,7-dione;TOXOFLAVIN;1,6-Dimethylpyrimido[5,4-e]-1,2,4-triazine-5,7(1H,6H)-dione (ACI);Pyrimido[5,4-e]-as-triazine-5,7(1H,6H)-dione, 1,6-dimethyl- (7CI, 8CI);1,5,6,7-Tetrahydro-1,6-dimethylpyrimidino[5,4-e]triazine-5,7-dione;K4394;NSC 67078;PKF 118-310;PKF118-310;SID 4251194;Toxoflavine;Xanthothricin;Xanthotricin |
| SMILES: | O=C1N(C)C(=O)C2=NC=NN(C2=N1)C |
| Formula: | C7H7N5O2 |
| M.Wt: | 193.162780046463 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | PKF118-310 is an inhibitor of survivin expression and antagonist of Tcf4/b-catenin signaling. Shown to induce apoptosis in tumor cells. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
