| Cas No.: | 878419-78-4 |
| Chemical Name: | Walrycin-B |
| Synonyms: | Walrycin-B |
| SMILES: | N(C)1C2=NC(=O)N(C)C(=O)C2=NC(C2=CC=C(C(F)(F)F)C=C2)=N1 |
| Formula: | C14H10F3N5O2 |
| M.Wt: | 337.26 |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | Walrycin B is a novel antibacterial compound specifically targeting the essential WalR response regulator.Walrycin B is known as an analog of toxoflavin (a phytotoxin from Burkholderia glumae), which has been shown to have a strong MIC for B. subtilis and S. aureus but whose mode of action is not clear. The compound could also interact with WalR to cause bactericidal effects. Walrycins are a new class of potent small molecule compounds that kill bacterial cells by targeting the RR WalR and inhibiting this essential signal transduction pathway. They not only have therapeutic potential but will also prove to be useful reagents for the further study of the WalK/WalR TCS. Walrycin B target WalR andlead to cell death in both B. subtilis and S. aureus. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
