| Cas No.: | 2655502-29-5 |
| Chemical Name: | GPS491 |
| Synonyms: | GPS491 |
| SMILES: | N(C1=NC2=CC=C(C(F)(F)F)C=C2S1)C(C1=CN=C(C(F)(F)F)S1)=O |
| Formula: | C13H5F6N3Os2 |
| M.Wt: | 397.318720579147 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | GPS491 (EC50 = 0.47 μM) suppresses expression of the HIV-1 structural protein Gag and alters HIV-1 RNA accumulation, decreasing the abundance of RNAs encoding the structural proteins while increasing levels of viral RNAs encoding the regulatory proteins. |
| References: | [1]. Zamiri M, et al. 2-Trifluoromethylthiazole-5-carboxamides: Analogues of a Stilbene-Based Anti-HIV Agent that Impact HIV mRNA Processing. ACS Med Chem Lett. 2021 Oct 29;12(11):1818-1823. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
