| Cas No.: | 1332184-63-0 |
| Chemical Name: | IL-4-inhibitor-1 |
| Synonyms: | 2-amino-4-(3,4-dihydroxyphenyl)-6-(4-fluorophenyl)-3-pyridinecarbonitrile;2-amino-4-(3,4-dihydroxyphenyl)-6-(4-fluorophenyl)nicotinonitrile;2-AMINO-4-(3,4-DIHYDROXYPHENYL)-6-(4-FLUOROPHENYL)PYRIDINE-3-CARBONITRILE;IL-4-inhibitor-1;CHEMBL5266734;CS-0179575;SCHEMBL23833502;HY-139092;IL-4 Inhibitor;MS-24745;AKOS040755315;DA-74436;G14072;1332184-63-0;BDBM50409058 |
| SMILES: | FC1C=CC(=CC=1)C1C=C(C(C#N)=C(N)N=1)C1C=CC(=C(C=1)O)O |
| Formula: | C18H12FN3O2 |
| M.Wt: | 321.305187225342 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
