| Cas No.: | 77472-98-1 |
| Chemical Name: | PK-8165; PK8165; PK 8165 |
| Synonyms: | PK-8165; PK8165; PK 8165 |
| SMILES: | C1CNCCC1CCC2=CC(=NC3=CC=CC=C32)C4=CC=CC=C4 |
| Formula: | C22H24N2 |
| M.Wt: | 316.44 |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | Pipequaline (PK 8165) is a non-selective GABAA receptor partial agonist with anxiolytic activity. |
| In Vivo: | Intravenously administered pipequaline exerts a partial suppression of activations by kainate, glutamate and acetylcholine. Microiontophoretic applications of pipequaline reduces the neuronal activation by kainate[2]. Pipequaline produces dose-related decreases in motor activity. Pipequaline produces significant dose-related decreases in the number of head-dips made[3]. |
| In Vitro: | Pipequaline is extensively bound to plasma proteins: i.e. human serum albumin (HSA), alpha-1-acid glycoprotein (AAG), lipoproteins and blood cells, mainly erythrocytes[1]. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
