| Cas No.: | 1496997-41-1 |
| Chemical Name: | 2-(2,6-Dioxopiperidin-3-yl)-5,6-difluoroisoindoline-1,3-dione |
| Synonyms: | Thalidomide-5,6-F;2-(2,6-dioxopiperidin-3-yl)-5,6-difluoroisoindoline-1,3-dione;2-(2,6-dioxopiperidin-3-yl)-5,6-difluoro-2,3-dihydro-1H-isoindole-1,3-dione;2-(2,6-dioxopiperidin-3-yl)-5,6-difluoroisoindole-1,3-dione;ZB1849;AT17986;SY289994 |
| SMILES: | FC1=C(C([H])=C2C(=C1[H])C(N(C2=O)C1([H])C(N([H])C(C([H])([H])C1([H])[H])=O)=O)=O)F |
| Formula: | C13H8F2N2O4 |
| M.Wt: | 294.2104 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
