DC Chemicals' products qualify for U.S. tariff exemptions. We guarantee no price increases due to customs duties and maintain stable supply, continuing to deliver reliable research solutions to our American clients.
| Cas No.: | 1205550-99-7 |
| Chemical Name: | AV-105 |
| Synonyms: | AV-105;AV 105;AV105 |
| SMILES: | O=C(OC(C)(C)C)N(C)C1=CC=C(/C=C/C2=CC=C(OCCOCCOCCOS(=O)(C3=CC=C(C)C=C3)=O)N=C2)C=C1 |
| Formula: | C32H40N2O8S |
| M.Wt: | 612.73 |
| Purity: | >98% |
| Sotrage: | Pure form-20°C3 years4°C2 yearsIn solvent-80°C6 months-20°C1 month |
| Publication: | [1]. Tyler Benedum, et al. Synthesis of 18f-radiolabeled styrylpyridines from tosylate precursors and stable pharmaceutical compositions thereof. WO2010078370A1. |
| Description: | AV-105 is a Florbetapir (18F)-radiolabeled slyrylpyridine tosylate precursor extracted from patent WO2010078370A1, example 1.5. AV-105 can synthesize 18F-radiolabeled compounds, which are used for positron emission tomography (PET) imaging of neurodegenerative diseases of the brain[1]. |
| In Vitro: | The AV-105 synthesis method utilizes a primary tosylate instead of a primary mesylate as an active leaving group. Use of the tosylate precursor for radiofluorination is beneficial, at least for the reason that the tosylate generated during the radiofluorination reaction is readily removed by chromatographic means from the 18F-radiolabeled imaging product[1]. |
| References: | [1]. Tyler Benedum, et al. Synthesis of 18f-radiolabeled styrylpyridines from tosylate precursors and stable pharmaceutical compositions thereof. WO2010078370A1. |
MSDS
| TITLE | DOWNLOAD |
| MSDS_23286_DC40273_1205550-99-7 |
|
COA
| LOT NO. | DOWNLOAD |
|
|