| Cas No.: | 2482-00-0 |
| Chemical Name: | 2-(4-Aminobutyl)guanidine sufate |
| Synonyms: | Agmatine Sulfate |
| SMILES: | N/C(N)=N\CCCCN.O=S(O)(O)=O |
| Formula: | C5H16N4O4S |
| M.Wt: | 228.267 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
