Cas No.: | 155569-91-8 |
SMILES: | [O-]C(C1C=CC=CC=1)=O.CC[C@@H]([C@@H]1[C@@H](C)C=C[C@@]2(O[C@@H]3CC=C([C@H]([C@H](C=CC=C4[C@]5(O)[C@@H]([C@@H](C(=C[C@H]5C(O[C@@H](C3)C2)=O)C)O)OC4)C)O[C@@H]2O[C@@H](C)[C@H](O[C@@H]3O[C@@H](C)[C@H]([NH2+]C)[C@@H](OC)C3)[C@@H](OC)C2)C)O1)C |t:21,25,27| |
Formula: | C104H154N2O28 |
M.Wt: | 1880.33 |
Purity: | >98% |
Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
Description: | Emamectin Benzoate works as a chloride channel activator by binding gamma aminobutyric acid (GABA) receptor and glutamate-gated chloride channels disrupting nerve signals within arthropods.Emamectin Benzoate stimulates the release of GABA from the synapses between nerve cells and while additionally increasing GABA's affinity for its receptor on the post-junction membrane of muscle cells in insects and arthropods. |