| Cas No.: | 29094-61-9 |
| SMILES: | CC1=CN=C(C(NCCC2C=CC(S(NC(NC3CCCCC3)=O)(=O)=O)=CC=2)=O)C=N1 |
| Formula: | C21H27N5O4S |
| M.Wt: | 445.54 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | Glipizide is used to treat high blood sugar levels caused by a type of diabetes mellitus called type 2 diabetes.Glipizide is an oral rapid- and short-acting anti-diabetic drug from the sulfonylurea class. It is classified as a second generation sulfonylurea, which means that it undergoes enterohepatic circulation. Mechanism of action is produced by blocking potassium channels in the beta cells of the islets of Langerhans. By partially blocking the potassium channels, the cell remains depolarized, increasing the time the cell spends in the calcium release stage, which results in signaling leading to calcium influx. The increase in calcium will initiate more insulin release from each beta cell. Sulfonylureas may also cause the decrease of serum glucagon and potentiate the action of insulin at the extrapancreatic tissues . |
MSDS
COA
| LOT NO. | DOWNLOAD |
|
|
|
| 2018-0101 |
|