Cas No.: | 25717-80-0 |
SMILES: | CCO/C(=N/C1ON=[N+](N2CCOCC2)C=1)/[O-] |
Formula: | C9H14N4O4 |
M.Wt: | 242.23 |
Purity: | >98% |
Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
Description: | Molsidomine is an orally active, long acting vasodilating drug, metabolized in the liver to the active metabolite linsidomine, which is an unstable compound that releases nitric oxide (NO) upon decay as the actual vasodilating compound. |