| Cas No.: | 21829-25-4 |
| SMILES: | COC(C1C(C)=NC(C)=C(C(OC)=O)[C@@H]1C1=CC=CC=C1[N+]([O-])=O)=O |
| Formula: | C17H18N2O6 |
| M.Wt: | 346.33 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | Nifedipine(Adalat), a potent vasodilator agent with calcium antagonistic action.Nifedipine has been formulated as both a long- and short-acting 1,4-dihydropyridine calcium channel blocker. It acts primarily on vascular smooth muscle cells by stabilizing voltage-gated L-type calcium channels in their inactive conformation. By inhibiting the influx of calcium in smooth muscle cells, nifedipine prevents calcium-dependent myocyte contraction and vasoconstriction. A second proposed mechanism for the drug's vasodilatory effects involves pH-dependent inhibition of calcium influx via inhibition of smooth muscle carbonic anhydrase. Nifedipine is used to treat hypertension and chronic stable angina. Nifedipine is a useful anti-anginal agent that also lowers blood pressure. Nifedipine is a dihydropyridine calcium channel blocker. It is also commonly used for the small subset of pulmonary hypertension patients whose symptoms respond to calcium channel blockers. |
MSDS
COA
| LOT NO. | DOWNLOAD |
|
|
|
| 2018-0101 |
|