| Cas No.: | 149845-06-7 |
| Chemical Name: | (S)-N1-((2S,3R)-4-((3S,4aS,8aS)-3-(tert-butylcarbamoyl)octahydroisoquinolin-2(1H)-yl)-3-hydroxy-1-phenylbutan-2-yl)-2-(quinoline-2-carboxamido)succinamide mesylate |
| Synonyms: | Ro 31-8959; Ro 31-8959/000; Ro 318959; Sch 52852; Sch-52852; Sch52852; Saquinavir; brand names Invirase and Fortovase. |
| SMILES: | C(N[C@H](CC1=CC=CC=C1)[C@@H](O)CN1[C@@H](C(NC(C)(C)C)=O)C[C@@]([H])2[C@]([H])(C1)CCCC2)(=O)[C@H](NC(C1C=CC2C(N=1)=CC=CC=2)=O)CC(N)=O.OS(C)(=O)=O |
| Formula: | C39H54N6O8S |
| M.Wt: | 766.3724 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | Saquinavir(Ro 31-8959) is an HIV Protease inhibitor used in antiretroviral therapy. Saquinavir is a protease inhibitor. Proteases are enzymes that cleave protein molecules into smaller fragments. HIV protease is vital for both viral replication within the cell and release of mature viral particles from an infected cell. Saquinavir binds to the active site of the viral protease and prevents cleavage of viral polyproteins, preventing maturation of the virus. Saquinavir inhibits both HIV-1 and HIV-2 proteases.Studies have also looked at Saquinavir as a possible anti-cancer agent. |
MSDS
COA
| LOT NO. | DOWNLOAD |
|
|
|
| 2018-0101 |
|