| Cas No.: | 2267306-14-7 |
| Chemical Name: | Pomalidomide-PEG2-azide |
| Synonyms: | Pomalidomide-PEG2-azide PomalidomidePEG2azide,Pomalidomide PEG2 azide |
| SMILES: | O=C(NC1=CC=CC(C(N2C(CC3)C(NC3=O)=O)=O)=C1C2=O)COCCOCCN=[N+]=[N-] |
| Formula: | C19H20N6O7 |
| M.Wt: | 444.4 |
| Purity: | >98% |
| Sotrage: | Please store the product under the recommended conditions in the Certificate of Analysis. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
