| Cas No.: | 669749-25-1 |
| Chemical Name: | 2-((4,6-dimethylquinazolin-2-yl)amino)-6-(((5-methyl-1,3,4-thiadiazol-2-yl)thio)methyl)pyrimidin-4(3H)-one |
| Synonyms: | VISTA modulator 6809-0223; VISTA modulator 68090223; VISTA modulator 6809 0223; |
| SMILES: | O=C1NC(NC2=NC(C)=C3C=C(C)C=CC3=N2)=NC(CSC4=NN=C(C)S4)=C1 |
| Formula: | C18H17N7Os2 |
| M.Wt: | 411.50 |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
