| Cas No.: | 64907-22-8 |
| Chemical Name: | Cholest-5-ene-3,7,25-triol,(3b,7a)- |
| Synonyms: | Cholest-5-ene-3,7,25-triol,(3b,7a)-;3β,7α,25-Trihydroxycholest-5-ene;3β,7α,25-Trihydroxyc;7α,25-dihydroxy Cholesterol;25-DIHYDROXYCHOLESTEROL;3b,7a,25-Trihydroxycholest-5-ene;7a,25-Dihydroxycholesterol;5-Cholesten-3β,7α,25-triol;cholest-5-ene-3β,7α,25-triol |
| SMILES: | OC1C=C2C(C)(CCC(O)C2)C2C1C1C(C)(CC2)C(C(C)CCCC(O)(C)C)CC1 |
| Formula: | C27H46O3 |
| M.Wt: | 418.652348995209 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | 7α, 25-dihydroxycholesterol (7α,25-OHC) is a potent and selective agonist and endogenous ligand of the orphan GPCR receptor EBI2 (GPR183). 7α, 25-dihydroxycholesterol is highly potent at activating EBI2 (EC50=140 pM; Kd=450 pM). 7α, 25-dihydroxycholesterol can serve as a chemokine directing migration of B cells, T cells and dendritic cells[1][2]. |
| Target: | Human Endogenous Metabolite |
| In Vivo: | EBI2-deficient B cells or normal B cells desensitized by 7α,25-Dihydroxycholesterol (1 μM; 1.5 hours) pre-treatment shows reduced homing to follicular areas of the spleen[1]. |
| In Vitro: | In vitro, 7α, 25-dihydroxycholesterol (7α,25-OHC) stimulates the migration of EBI2-expressing mouse B and T cells with half-maximum effective concentration values around 500 pM, but had no effect on EBI2-deficient cells[1]. |
| References: | [1]. Liu C, et al. Oxysterols direct B-cell migration through EBI2. Nature. 2011 Jul 27;475(7357):519-23. [2]. Hannedouche S, et al. Oxysterols direct immune cell migration via EBI2. Nature. 2011 Jul 27;475(7357):524-7. |
MSDS
COA
| LOT NO. | DOWNLOAD |
|
|
|
| 2018-0101 |
|