| Cas No.: | 1186206-79-0 |
| Chemical Name: | Eph receptor tyrosine kinase inhibitor |
| Synonyms: | Eph receptor tyrosine kinase inhibitor |
| SMILES: | CC1=C(NC(C2=CC(C3=CC=CS3)=CN=C2)=O)C=C(C(NC4=CC=C(CN5CCN(CC)CC5)C(C(F)(F)F)=C4)=O)C=C1 |
| Formula: | C32H32F3N5O2S |
| M.Wt: | 607.69 |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | ALW-II-41-27 is a Eph family tyrosine kinase inhibitor with an IC50 of 11 nM for Eph2. |
| In Vitro: | ALW-II-41-27 inhibits Ba/F3 cells transformed with Tel fusions of EphA3, Kit, Fms, KDR, FLT1, FGR, Src, Lyn, Bmx, and Bcr-Abl with an EC50 below 500 nM. ALW-II-41-27 exhibits cross reactivity with Bcr-Abl. ALW-II-41-27 inhibits b-raf, CSF1R, DDR1, DDR2, EphA2, EphA5, EphA8, EphB1, EphB2, EphB3, Frk, Kit, Lck, p38α, p38β, PDGFRα, PDGFRβ, and Raf1 and many more demonstrating how introduction of the thiophene group can have a tremendous impact on kinase selectivity[1]. |
MSDS
COA
| LOT NO. | DOWNLOAD |
|
|
|
| 2018-0101 |
|
| 2018-0101 |
|