| Cas No.: | 1338320-94-7 |
| Chemical Name: | (E)-N-hydroxy-3-(1-(phenylsulfonyl)indolin-5-yl)acrylamide |
| SMILES: | C(NO)(=O)/C=C/C1C=CC2=C(C=1)CCN2S(C1=CC=CC=C1)(=O)=O |
| Formula: | C17H16N2O4S |
| M.Wt: | 344.385 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | MPT0E028 is a potent HDAC inhibitor that inhibits nuclear HDAC activity with IC50 of 11.1 nM in HeLa cells, 9-30 times more potent than SAHA; inhibits class I HDAC1, HDAC2, and class Iib HDAC6 with IC50 of 53, 106, and 29.5 nM, respectively, weakly inhibits HDAC8 (IC50=2.5 uM), but not for HDAC4 (IC50>10 uM); inhibits the growth of HCT116 and MDA-MB-231 cells with IC50 of 0.09 and 0.19 uM; inhibits HCT116 tumor xenograft in vivo without significant adverse effects, shows stronger anti-cancer efficacy than SAHA. |
MSDS
COA
| LOT NO. | DOWNLOAD |
|
|
|
| 2018-0101 |
|