Cas No.: | 1985606-14-1 |
Chemical Name: | Baloxavir marboxil |
Synonyms: | Baloxavir Marboxil;baloxavir-marboxil;505CXM6OHG |
SMILES: | O=C(OCOC(C(C=C1)=O)=C(N1N([C@@H]2C3=CC=CC=C3SCC4=C(F)C(F)=CC=C24)[C@@]5([H])N6CCOC5)C6=O)OC |
Formula: | C27H23F2N3O7S |
M.Wt: | 571.5492 |
Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
Description: | Baloxavir marboxil is a prodrug of S-033447. S-033447 is a small molecule inhibitor of the cap-dependent endonuclease of influenza A and B viruses. |