| Cas No.: | 1254472-97-3 |
| Chemical Name: | 2-(3-pentylphenyl)acetic acid, sodium salt |
| Synonyms: | Setogepram sodium |
| SMILES: | [Na+].C([O-])(=O)CC1=CC=CC(CCCCC)=C1 |
| Formula: | C13H18NaO2 |
| M.Wt: | 229.275 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | PBI-4050 (Setogepram, PBI4050) is a synthetic analog of a medium-chain fatty acid that displays agonist and antagonist ligand affinity toward GPR40 and GPR84, respectively; PBI-4050 significantly attenuated fibrosis in many injury contexts, as evidenced by the antifibrotic activity observed in kidney, liver, heart, lung, pancreas, and skin fibrosis models; PBI-4050 is a first-in-class compound that may be effective for managing inflammatory and fibrosis-related diseases. |
MSDS
COA
| LOT NO. | DOWNLOAD |
|
|
|
| 2018-0101 |
|