Cas No.: | 100079-26-3 |
Chemical Name: | 1-Nonanone,1-(3,4,5-trihydroxyphenyl)- |
Synonyms: | 1-Nonanone,1-(3,4,5-trihydroxyphenyl)-;1-(3,4,5-trihydroxyphenyl)nonan-1-one |
SMILES: | OC1=C(O)C(O)=CC(C(=O)CCCCCCCC)=C1 |
Formula: | C15H22O4 |
M.Wt: | 266.332785129547 |
Purity: | >98% |
Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
Description: | A potent nuclear receptor TR3 (Nur77)-specific targeting compound that can induce melanoma autophagy through a mitochondrial signaling pathway; binds TR3 to facilitate the interaction with Nix, induces TR3 localization to MIM; significantly represses tumor growth in xenograft mouse model; a chemical probe to study TR3-mediated signal transduction pathway. |