DC Chemicals' products qualify for U.S. tariff exemptions. We guarantee no price increases due to customs duties and maintain stable supply, continuing to deliver reliable research solutions to our American clients.
| Cas No.: | 648927-86-0 |
| Chemical Name: | (S)-3-amino-4-(((S)-2-amino-4-sulfobutyl)disulfaneyl)butane-1-sulfonic acid |
| Synonyms: | QGC 001;RB 150 |
| SMILES: | C(S(O)(=O)=O)C[C@@H](N)CSSC[C@H](N)CCS(O)(=O)=O |
| Formula: | C8H20N2O6S4 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | A potent, orally active, centrally acting aminopeptidase inhibitor, the prodrug of the specific and selective aminopeptidase A inhibitor EC33; blocks the brain renin-angiotensin system activity and normalises blood pressure,with no effect on the systemic renin-angiotensin-aldosterone parameters and on PCop concentrations. |
MSDS
COA
| LOT NO. | DOWNLOAD |
|
|
|
| 2018-0101 |
|