| Cas No.: | 1225278-16-9 |
| Chemical Name: | DCC-2618,DCC2618,DCC 2618 |
| Synonyms: | DCC-2618,DCC2618,DCC 2618 |
| SMILES: | CN1C=C(C=N1)C2=NC=CC(=C2)OC3=C(C=C(C(=C3)F)NC(=O)C4(CC4)C(=O)NC5=CC=CC=C5)F |
| Formula: | C26H21F2N5O3 |
| M.Wt: | 489.4734 |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Publication: | [1]. Daniel L. Flynn, et al. Cyclopropane amides and analogs exhibiting anti-cancer and anti-proliferative activities. WO 2010051373 A1 |
| Description: | c-Kit-IN-1 is a potent inhibitor of c-Kit and c-Met with IC50s of <200 nM. |
| In Vitro: | c-Kit-IN-1 is a c-Kit and c-Met inhibitor extracted from patent 2010051373A1, compound example 45, has an IC50 of <200 nM. c-Kit-IN-1 also inhibits KDR, PDGFR α and β with IC50s of <2 μM, <10 μM and <10 μM, respectively[1]. |
MSDS
COA
| LOT NO. | DOWNLOAD |
|
|
|
| 2018-0101 |
|
| 2018-0101 |
|