| Cas No.: | 1831167-98-6 |
| Chemical Name: | N-[4-[(1S,2R)-2-Aminocyclopropyl]phenyl]-4-(4-methyl-1-piperazinyl)-benzamide dihydrochloride |
| Synonyms: | DDP-38003 2HCl; DDP 38003 2HCl; DDP38003 2HCl; DDP-38003 dihydrochloride; DDP 38003 dihydrochloride; DDP38003 dihydrochloride; |
| SMILES: | [H]Cl.O=C(NC1=CC=C([C@@H]2C[C@H]2N)C=C1)C(C=C3)=CC=C3N4CCN(C)CC4.[H]Cl |
| Formula: | C21H28Cl2N4O |
| M.Wt: | 423.38 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | DDP-38003 inhibits KDM1A with an IC50 of 84 nM. DDP-38003 is more active in reducing the colony forming ability and in inducing thedifferentiation of THP-1 cells compared to the 1R, 2S analogue.DDP-38003 exhibits in vivo efficacy after oral administration, determining a 62% increased survival in mouse leukemia models with evidence of KDM1A inhibition. The half life of DDP-38003 is 8 h. A significant dose dependent increase of mice survival is obtained by DDP-38003 treatment. The survival rate increases 35% and 62% at the dose of 11.25 and 22.50 mg/kg, respectively. DDP-38003 is a potential oral anticancer agent. |
MSDS
COA
| LOT NO. | DOWNLOAD |
|
|
|
| 2018-0101 |
|