| Cas No.: | 1392487-51-2 |
| Chemical Name: | (3as,4r,9br)-4-(6-bromo-1,3-benzodioxol-5-yl)-8-isopropyl-3a,4,5, 9b-tetrahydro-3h-cyclopenta[c]quinoline |
| Synonyms: | (3aS,4R,9bR)-4-(6-Bromo-1,3-benzodioxol-5-yl)-8-isopropyl-3a,4,5, 9b-tetrahydro-3H-cyclopenta[c]quinoline;G-36 |
| SMILES: | BrC1=CC2OCOC=2C=C1C1C2CC=CC2C2=C(C=CC(C(C)C)=C2)N1 |
| Formula: | C22H22BrNO2 |
| M.Wt: | 412.319585323334 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | G-36 is a cell-permeable non-steroidal antagonist of GPER, inhibiting activation by either 17β-estradiol or the GPER-selective agonist G-1(IC50 = 112 and 165 nM, respectively).It has no detectable binding activity to either ERα or ERβ.G-36 blocks the activation of PI3K or calcium mobilization triggered by estrogen through GPER and it suppresses ERK activation by estrogen or G-1 but not by EGF.3 G-36 can be used in combination with GPER-selective agonists, like G-1, to distinguish the roles of GPER from those of ERα and ERβ in complex biological systems. |
MSDS
COA
| LOT NO. | DOWNLOAD |
|
|
|
| 2018-0101 |
|
| 2018-0101 |
|