| Cas No.: | 1513879-19-0 |
| Chemical Name: | KDU691 |
| Synonyms: | KDU691 |
| SMILES: | ClC1=CC=C(N(C(C2=CN3C(C=N2)=NC=C3C4=CC=C(C(NC)=O)C=C4)=O)C)C=C1 |
| Formula: | C22H18ClN5O2 |
| M.Wt: | 419.869 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | KDU691 is a PI4K inhibitor. |
| In Vivo: | During the 5 days of dosing, no major weight changes are observed in the animals that receive KDU691 as prophylactic treatment (group 691-proph). From the fourth day of dosing, the animals that are treated with KDU691 show a transient yellow skin color. The KDU691 radical-cure group (group 691-RC) becomes blood-stage positive again at 31.8±0.5 days p.i. (range, 31 to 32 days). Clinical chemistry analysis of the group 691-RC monkeys reveals that bilirubin levels accumulate during the 5-day radical-cure treatment with KDU691[1]. |
MSDS
COA
| LOT NO. | DOWNLOAD |
|
|
|
| 2018-0101 |
|
| 2018-0101 |
|