| Cas No.: | 124875-20-3 |
| Synonyms: | KP1019; KP 1019; KP1019; FFC14A; indazolium transtetrachlorobis(1Hindazole)ruthenate(III). |
| SMILES: | [Cl-][Ru+3]([Cl-])([Cl-])([N]1=CC(C=CC=C2)=C2N1)([N]3=CC(C=CC=C4)=C4N3)[Cl-].C56=C(NN=C6)C=CC=C5.[H+] |
| Formula: | C21H19Cl4N6Ru |
| M.Wt: | 598.3 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | KP1019, also known as FFC14A, is just the second ruthenium-based anticancer agent after NAMI-A which was developed to the stage of clinical trials. Important steps in the mode of action of KP1019 are thought to be the binding to the serum protein transferrin and the transport into the cell via the transferrin pathway. Additionally, the selective activation by reduction in the tumor might contribute to the low side effects observed in in vivo studies. |
MSDS
COA
| LOT NO. | DOWNLOAD |
|
|
|
| 2018-0101 |
|