| Cas No.: | 2648693-32-5 |
| Chemical Name: | ORNA Lipid 10a-26 |
| Synonyms: | Decanoic acid, 2-hexyl-, 1,1′-[[[3-(1H -imidazol-1-yl)propyl]imino]di-6, 1-hexanediyl] ester (ACI),Lipid A26,ORNA Lipid 10a26 |
| SMILES: | O=C(OCCCCCCN(CCCN1C=NC=C1)CCCCCCOC(=O)C(CCCCCC)CCCCCCCC)C(CCCCCC)CCCCCCCC |
| Formula: | C50H95N3O4 |
| M.Wt: | 802.31 |
| Purity: | ELSD-HPLC>95% |
| Sotrage: | 1 year -20°C |
| Publication: | Circular RNA compositions for targeted and efficient therapeutic protein expression in immune cells for treating cancer or autoimmune disease By: Wesselhoeft, Alex; Goodman, Brian-WO2021189059 A2 2021-09-23 |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.

