| Cas No.: | 1610954-97-6 |
| Chemical Name: | N-(1-((2-(Dimethylamino)ethyl)amino)-2-methyl-1-oxopropan-2-yl)-4-(4-(2-methyl-5-((2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(methylthio)tetrahydro-2H-pyran-2-yl)benzyl)phenyl)-butanamide |
| Synonyms: | LX2761; LX-2761; LX 2761,1610954-97-6 |
| SMILES: | O=C(NC(C)(C)C(NCCN(C)C)=O)CCCC1=CC=C(CC2=CC([C@H]3[C@H](O)[C@@H](O)[C@H](O)[C@@H](SC)O3)=CC=C2C)C=C1 |
| Formula: | C32H47N3O6S |
| M.Wt: | 601.31 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | LX2761 is a locally acting SGLT1 inhibitor that is highly potent in vitro and delays intestinal glucose absorption in vivo to improve glycemic control. LX2761 has hSGLt1 2.2 nM; hSGLT2 2.7 nM and F% =<2. LX2761 is a very potent, chemically stable, and luminally restricted molecule that achieved proof of concept in OGTT at very low doses. LX2761 was designed to remain in the intestine after oral delivery to inhibit SGLT1 locally without affecting the SGLT1/2 mechanism in the kidney. |
MSDS
COA
| LOT NO. | DOWNLOAD |
|
|
|
| 2018-0101 |
|
| 2018-0101 |
|