| Cas No.: | 388082-77-7 |
| Chemical Name: | N-(3-chloro-4-((3-fluorobenzyl)oxy)phenyl)-6-(5-(((2-(methylsulfonyl)ethyl)amino)methyl)furan-2-yl)quinazolin-4-amine ditosylate |
| Synonyms: | GSK572016; GSK-572016; GSK 572016; GW2016; GW-2016; GW 2016; Lapatinib; Lapatinib ditosylate; Brand name: Tykerb. CAT#100490B. |
| SMILES: | O=S(CCNCC1=CC=C(C2=CC=C3C(C(NC4=CC(Cl)=C(C=C4)OCC5=CC(F)=CC=C5)=NC=N3)=C2)O1)(C)=O.O=S(C6=CC=C(C)C=C6)(O)=O.O=S(C7=CC=C(C)C=C7)(O)=O |
| Formula: | C43H42ClFN4O10S3 |
| M.Wt: | 925.46 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | Lapatinib ditosylate(GW-572016 ditosylate) is a potent EGFR and ErbB2 inhibitor with IC50 of 10.8 and 9.2 nM, respectively. Lapatinib ditosylate is a selective and effective inhibitor of ErbB-2 and EGFR dual tyrosine kinases. ErbB-2 and EGFR dual tyrosine kinases are growth promoting factors that are over expressed in some breast cancer cell lines. Research studies have reported that Lapatinib Ditosylate can inhibit breast cancer cell proliferation. |
MSDS
COA
| LOT NO. | DOWNLOAD |
|
|
|
| 2018-0101 |
|