| Cas No.: | 201653-76-1 |
| Synonyms: | NAMIA,NAMI A |
| SMILES: | [Cl-][Ru+3]([Cl-])([Cl-])([Cl-])([N]1=CNC=C1)S(C)(C)=O.[H+].C2=NC=CN2 |
| Formula: | C8H15Cl4N4ORuS |
| M.Wt: | 458.18 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | NAMI-A is a ruthenium anticancer agent and a metastasis inhibitor. NAMI is an acronym for "New Anti-tumour Metastasis Inhibitor", while the -A suffix indicates that this is the first of a potential series. NAMI-A is a potent agent for the treatment of solid tumor metastases as well as when these tumor lesions are in an advanced stage of growth. NAMI-A is endowed with a mechanism of action unrelated to direct tumor cell cytotoxicity, and such mechanism of action is responsible for a reduced host toxicity. |
MSDS
COA
| LOT NO. | DOWNLOAD |
|
|
|
| 2018-0101 |
|