Cas No.: | 54527-84-3 |
SMILES: | Cl.CN(CC1=CC=CC=C1)CCOC(C1=C(C)NC(C)=C(C(OC)=O)C1C1=CC=CC([N+]([O-])=O)=C1)=O |
Formula: | C26H30ClN3O6 |
M.Wt: | 515.99 |
Purity: | >98% |
Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
Description: | Nicardipine Hcl(YC-93) is a calcium channel blocker that has been widely used to control blood pressure in severe hypertension following events such as ischemic stroke, traumatic brain injury, and intracerebral hemorrhage. |