| Cas No.: | 175135-47-4 |
| Chemical Name: | 4-[(4-Methoxyphenyl)methoxy]benzeneacetonitrile |
| Synonyms: | OSI1,OSI 1 |
| SMILES: | C(CC#N)1=CC=C(OCC2=CC=C(OC)C=C2)C=C1 |
| Formula: | C16H15NO2 |
| M.Wt: | 253.3 |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | O4I1 is as a potent Oct3/4 inducer.Target: Oct3/4O4I1 enhances Oct3/4 gene expression, increases Oct3/4 protein levels, and promotes Oct3/4 mediated transcriptional activation. O4I1 activates Oct3/4 at the transcriptional and translational levels in diverse human cell lines. O4I1 promotes Oct3/4 expression in untransfected HEK293 cells quantified by qRT-PCR after 72 h of treatment. O4I1 is sufficient to enhance Oct3/4 overexpression 2-fold and 3-fold after 48 and 72 h of treatment, respectively. |
MSDS
COA
| LOT NO. | DOWNLOAD |
|
|
|
| 2018-0101 |
|
| 2018-0101 |
|