| Cas No.: | 808118-40-3 |
| Chemical Name: | Glycine, N-[(4-hydroxy-1-methyl-7-phenoxy-3-isoquinolinyl)carbonyl]- |
| Synonyms: | Glycine, N-[(4-hydroxy-1-methyl-7-phenoxy-3-isoquinolinyl)carbonyl]-;FG-4592;N-[(4-Hydroxy-1-methyl-7-phenoxy-3-isoquinolinyl)carbonyl]glycine;2-[(4-hydroxy-1-methyl-7-phenoxyisoquinoline-3-carbonyl)amino]acetic acid;FG4592;Roxadustat;Roxadustat (FG-4592);(((4-Hydroxy-1-methyl-7-phenoxyisoquinolin-3-yl)carbonyl)amino)acetic acid;2-(4-HYDROXY-1-METHYL-7-PHENOXYISOQUINOLINE-3-CARBOXAMIDO)ACETIC ACID;Glycine,N-[(4-hydroxy-1-methyl-7-phenoxy-3-isoquinolinyl)carbonyl] |
| SMILES: | O=C(O)CNC(C1=C(O)C2=C(C(C)=N1)C=C(OC3=CC=CC=C3)C=C2)=O |
| Formula: | C19H16N2O5 |
| M.Wt: | 352.341 |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | Roxadustat (FG-4592) is an oral hypoxia-inducible factor (HIF) prolyl hydroxylase inhibitor developed for the treatment of anemia. |
| In Vivo: | Roxadustat (25 mg/kg) enhances mitophagy and attenuates retinal histopathologic damage in the photoreceptor layer after RD in an RD animal model[1]. |
| In Vitro: | Roxadustat significantly increases accumulation of HIF-1α and BNIP3, resultes in reduced TUNEL-positive photoreceptors 3 days after RD and an increased thickness of the outer nuclear layer 7 days after RD in the TUNEL-positive cells[1]. Roxadustat increases differentiation of adipose-derived mesenchymal stem cells (ADMSCs) under both hypoxia and normoxia[2]. |
MSDS
COA
| LOT NO. | DOWNLOAD |
|
|
|
| 2018-0101 |
|
| 2018-0101 |
|