| Cas No.: | 1818389-84-2 |
| Synonyms: | SPHINX31 |
| SMILES: | O=C(C1=CC=C(C2=CC=NC=C2)O1)NC(C=C(C(F)(F)F)C=C3)=C3N(CC4)CCN4CC5=CC=CC=N5 |
| Formula: | C27H24F3N5O2 |
| M.Wt: | 507.5 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks4°C in DMSO,6 months-80°C in DMSO |
| Description: | SPHINX31 is a potent and selective inhibitor of serine/arginine-rich protein kinase 1 (SRPK1), with an IC50 of 5.9 nM. SPHINX31 inhibits phosphorylation of serine/arginine-rich splicing factor 1 (SRSF1), which is a SRPK1 substrate. SPHINX31 is a potential topical therapeutic for neovascular eye disease[1]. |
| Target: | IC50: 5.9 nM (SRPK1)[1]. |
| References: | [1]. Batson J, et al. Development of Potent, Selective SRPK1 Inhibitors as Potential Topical Therapeutics for Neovascular Eye Disease. ACS Chem Biol. 2017 Mar 17;12(3):825-832. |
MSDS
COA
| LOT NO. | DOWNLOAD |
|
|
|
| 2018-0101 |
|
| 2018-0101 |
|