| Cas No.: | 17318-31-9 |
| Chemical Name: | 9-(Tetrahydro-2-furanyl)-9H-purin-6-amine |
| Synonyms: | SQ 22536,SQ-22536 |
| SMILES: | N1C2C(=NC=NC=2N)N(C2CCCO2)C=1 |
| Formula: | C9H11N5O |
| M.Wt: | 205.22 |
| Sotrage: | 4°C for 1 year, -20°C for more than 2 years |
| Description: | SQ22536 is an effective adenylate cyclase (AC) inhibitor. |
| In Vitro: | SQ22536 (SQ22,536) effectively inhibits the effect of forskolin with respective IC50 values of 5 μM.Preincubation with graded concentrations of SQ22536 reveals that both SQ22536 effectively inhibits PACAP-induced reporter gene activation with approximate IC50 value of 5 μM. SQ22536 more potently inhibits forskolin-induced Elk activation (IC50=10 μM) than 8-Br-cAMP-induced Elk activation (IC50=170 μM). Most notably, there are substantial differences in the reported potencies of SQ22536 to inhibit the activities of recombinant AC5 and AC6, with respective IC50 values of 2 μM and 360 μM. At a greater concentration (500 μM), SQ22536 significantly inhibits neurite elongation due to either forskolin or 8-Br-cAMP[1]. |
MSDS
COA
| LOT NO. | DOWNLOAD |
|
|
|
| 2018-0101 |
|
| 2018-0101 |
|