| Cas No.: | 935467-97-3 |
| Chemical Name: | TH-237A(meso-GS 164) is a novel neuroprotective agent exhibiting favorable permeation across the blood brain barrier. IC50 value: 5 nM (EC50, concentration that leads to a 50% increase in neuronal survival in the presence of the Aβ peptides) Target: Prima |
| Synonyms: | TH 237A; TH237A; meso-GS 164 |
| SMILES: | C1C2(CO[C@H](N2[C@H](O1)C3=CC=C(C=C3)F)C4=CC=C(C=C4)F)CO |
| Formula: | C18H17F2NO3 |
| M.Wt: | 333.33 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | TH-237A(meso-GS 164) is a novel neuroprotective agent exhibiting favorable permeation across the blood brain barrier.Primary neurons were isolated from embryonic Sprague-Dawley rats, grown in culture (Michaelis et al., 1994) and exposed to either Aβ25-35 or Aβ1-42 in the presence or absence of TH-237A at concentrations ranging from 0.5 to 60 nM. The neurons were treated with TH-237A for 2 hours prior to exposure to the Aβ peptides. Changes in neuronal survival following treatment with TH 237A were evaluated using the Live/Dead assay. The EC50 for TH-237A was 5 nM, demonstrating that it had excellent neuroprotective properties. |
| Target: | IC50 value: 5 nM (EC50, concentration that leads to a 50% increase in neuronal survival in the presence of the Aβ peptides) |
| References: | [1]. Kelly E. Desino, Improving Blood Brain Barrier Permeation of Small Molecules Exhibiting Chemotherapeutic and Neuroprotective Effects. |
MSDS
COA
| LOT NO. | DOWNLOAD |
|
|
|
| 2018-0101 |
|
| 2018-0101 |
|