| Cas No.: | 1118460-77-7 |
| Chemical Name: | 2-amino-4-(4-methoxyphenyl)-7-(naphthalen-1-yl)-5-oxo-5,6,7,8-tetrahydro-4H-chromene-3-carbonitrile |
| Synonyms: | UCPH-101, UCPH 101, UCPH101 |
| SMILES: | N#CC1=C(N)OC2=C(C(CC(C3=C4C=CC=CC4=CC=C3)C2)=O)C1C5=CC=C(OC)C=C5 |
| Formula: | C27H22N2O3 |
| M.Wt: | 422.48 |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | UCPH-101 is an excitatory amino acid transporter subtype 1 (EAAT1) inhibitor with an IC50 of 0.66 μM. |
| In Vitro: | UCPH-101 and UCPH-102 inhibit EAAT1 anion currents in a concentration-dependent manner, with KD values of 0.34±0.03 μM (Hill=1.3±0.13, n≥9) for UCPH-101 and 0.17±0.02 μM (Hill=0.97±0.11, n≥7) for UCPH-102. A small but significant decrease in the total expression levels of both HA-EAAT1 and HA-GLAST is observed in cells preincubated with 100 μM UCPH-101 (p=0.048)[1]. |
MSDS
COA
| LOT NO. | DOWNLOAD |
|
|
|
| 2018-0101 |
|
| 2018-0101 |
|