| Cas No.: | 878385-84-3 |
| Chemical Name: | N-(2-((2,3-difluorobenzyl)thio)-6-(((2R,3S)-3,4-dihydroxybutan-2-yl)oxy)pyrimidin-4-yl)azetidine-1-sulfonamide |
| Synonyms: | AZD-5069; AZD 5069; AZD5069,878385-84-3 |
| SMILES: | O=S(N1CCC1)(NC2=NC(SCC3=CC=CC(F)=C3F)=NC(O[C@H](C)[C@@H](O)CO)=C2)=O |
| Formula: | C18H22F2N4O5S2 |
| M.Wt: | 476.51 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | AZD-5069 is a potent CXCR2 chemokine receptor antagonist, used for caner treatment. |
| Target: | 125I-IL-8-CXCR2 |
| In Vitro: | AZD-5069 (Compound 2) acts as CXCR2 antagonist by inhibition of [125I]-IL-8 binding to human CXCR2 receptors and as inhibitor of GROα-induced Ca2+ flux in human neutrophils loaded with fluo-3 dye[1]. |
| References: | [1]. Norman P. Evidence on the identity of the CXCR2 antagonist AZD-5069. Expert Opin Ther Pat. 2013 Jan;23(1):113-7. |
MSDS
COA
| LOT NO. | DOWNLOAD |
|
|
|
| 2018-0101 |
|
| 2018-0101 |
|